cas: 1421754-24-6 — see every product listed under this CAS number, including other names
(4-((tert-Butoxycarbonyl)amino)-2-chlorophenyl)boronic acid 98% (CAS 1421754-24-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A803258-100mg |
| cas | 1421754-24-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1249.25 Pln | |
| Ambeed | 5g | 3607.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A803258 |
[2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 1421754-24-6) is a chemical compound with the molecular formula C11H15BClNO4 and a molecular weight of 271.51 g/mol. IUPAC name: [2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: TXTRMICCPSQYOU-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO4 |
|---|---|
| Molecular weight | 271.51 g/mol |
| IUPAC name | [2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | TXTRMICCPSQYOU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)NC(=O)OC(C)(C)C)Cl)(O)O |
Computed by PubChem (NCBI)