(4-((tert-Butoxycarbonyl)amino)-2-fluorophenyl)boronic acid, 98%
cas: 1415960-56-3 — see every product listed under this CAS number, including other names
(4-((tert-Butoxycarbonyl)amino)-2-fluorophenyl)boronic acid, 98% (CAS 1415960-56-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A511569-250mg |
| cas | 1415960-56-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1338.25 Pln | |
| Ambeed | 10g | 1972.38 Pln | |
| BLDpharm | 250mg | 336.57 Pln | |
| BLDpharm | 1g | 525.40 Pln | |
| BLDpharm | 5g | 1441.74 Pln | |
| BLDpharm | 10g | 2124.83 Pln | |
| BLDpharm | 25g | 4590.63 Pln | |
| Fluorochem | 10g | 7177.70 Pln | |
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 1143.37 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 1415960-56-3) is a chemical compound with the molecular formula C11H15BFNO4 and a molecular weight of 255.05 g/mol. IUPAC name: [2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: DAISURXDKVZMGH-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO4 |
|---|---|
| Molecular weight | 255.05 g/mol |
| IUPAC name | [2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | DAISURXDKVZMGH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)NC(=O)OC(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-((tert-Butoxycarbonyl)amino)-2-fluorophenyl)boronic acid, 4-(BOC-Amino)-2-fluorophenylboronic acid, [2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid, (4-{[(tert-butoxy)carbonyl]amino}-2-fluorophenyl)boronic acid, DAISURXDKVZMGH-UHFFFAOYSA-N, (4-((tert-Butoxycarbonyl)amino)-2-fluorophenyl)boronicacid, [4-(tert-butoxycarbonylamino)-2-fluoro-phenyl]boronic acid, 4-(BOC-Amino)-2-fluorophenylboronic acid(contains varying amounts of Anhydride)