cas: 957060-93-4 — see every product listed under this CAS number, including other names
(4-((tert-Butyldimethylsilyl)oxy)-3-methoxyphenyl)boronic acid, 98% (CAS 957060-93-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A777006-100mg |
| cas | 957060-93-4 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 428.05 Pln | |
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 659.16 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]boronic acid (CAS 957060-93-4) is a chemical compound with the molecular formula C13H23BO4Si and a molecular weight of 282.22 g/mol. IUPAC name: [4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]boronic acid. InChIKey: OQOAUYLMODKGHX-UHFFFAOYSA-N.
| Molecular formula | C13H23BO4Si |
|---|---|
| Molecular weight | 282.22 g/mol |
| IUPAC name | [4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]boronic acid |
| InChIKey | OQOAUYLMODKGHX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)O[Si](C)(C)C(C)(C)C)OC)(O)O |
Computed by PubChem (NCBI)