(4-(1,2,2-Triphenylvinyl)phenyl)boronic acid, 98%
cas: 1227040-87-0 — see every product listed under this CAS number, including other names
(4-(1,2,2-Triphenylvinyl)phenyl)boronic acid, 98% (CAS 1227040-87-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1156684-250mg |
| cas | 1227040-87-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 553.94 Pln | |
| Ambeed | 5g | 2473.00 Pln | |
| Ambeed | 25g | 8502.75 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 1192.40 Pln | |
| Chemat | 25g | 4029.20 Pln | |
| BLDpharm | 250mg | 192.18 Pln | |
| BLDpharm | 1g | 542.06 Pln | |
| BLDpharm | 5g | 2430.28 Pln | |
| BLDpharm | 25g | 8339.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[4-(1,2,2-triphenylethenyl)phenyl]boronic acid (CAS 1227040-87-0) is a chemical compound with the molecular formula C26H21BO2 and a molecular weight of 376.3 g/mol. IUPAC name: [4-(1,2,2-triphenylethenyl)phenyl]boronic acid. InChIKey: XSIVQWOJIOHPIZ-UHFFFAOYSA-N.
| Molecular formula | C26H21BO2 |
|---|---|
| Molecular weight | 376.3 g/mol |
| IUPAC name | [4-(1,2,2-triphenylethenyl)phenyl]boronic acid |
| InChIKey | XSIVQWOJIOHPIZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-(1,2,2-Triphenylvinyl)phenyl)boronic acid, [4-(1,2,2-triphenylethenyl)phenyl]boronic acid, B-[4-(1,2,2-Triphenylethenyl)phenyl]boronic acid, 4-(1,2,2-Triphenylvinyl)phenylboronic acid, [4-(1,2,2-triphenylvinyl)phenyl]boronic acid, Boronic acid, B-[4-(1,2,2-triphenylethenyl)phenyl]-, XSIVQWOJIOHPIZ-UHFFFAOYSA-N, (4-(1,2,2-Triphenylvinyl)phenyl)boronicacid