CAS 1227040-87-0 appears in our catalog under these names: (4–(1,2,2–Triphenylvinyl)phenyl)boronic acid, (4-(1,2,2-Triphenylvinyl)phenyl)boronic acid, 98%, 98%, (4-(1,2,2-Triphenylvinyl)phenyl)boronic acid, 97%, (4-(1,2,2-Triphenylvinyl)phenyl)boronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 500mg, 10g.
[4-(1,2,2-triphenylethenyl)phenyl]boronic acid (CAS 1227040-87-0) is a chemical compound with the molecular formula C26H21BO2 and a molecular weight of 376.3 g/mol. IUPAC name: [4-(1,2,2-triphenylethenyl)phenyl]boronic acid. InChIKey: XSIVQWOJIOHPIZ-UHFFFAOYSA-N.
| Molecular formula | C26H21BO2 |
|---|---|
| Molecular weight | 376.3 g/mol |
| IUPAC name | [4-(1,2,2-triphenylethenyl)phenyl]boronic acid |
| InChIKey | XSIVQWOJIOHPIZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4)(O)O |
Computed by PubChem (NCBI)