CAS 1256345-72-8 appears in our catalog under these names: 4-(1-Aminocyclopropyl)phenylboronic acid, HCl, 97%, 97%, (4-(1-Aminocyclopropyl)phenyl)boronic acid hydrochloride, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-(1-aminocyclopropyl)phenyl]boronic acid;hydrochloride (CAS 1256345-72-8) is a chemical compound with the molecular formula C9H13BClNO2 and a molecular weight of 213.47 g/mol. IUPAC name: [4-(1-aminocyclopropyl)phenyl]boronic acid;hydrochloride. InChIKey: KCTAZNMFDNLLCX-UHFFFAOYSA-N.
| Molecular formula | C9H13BClNO2 |
|---|---|
| Molecular weight | 213.47 g/mol |
| IUPAC name | [4-(1-aminocyclopropyl)phenyl]boronic acid;hydrochloride |
| InChIKey | KCTAZNMFDNLLCX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2(CC2)N)(O)O.Cl |
Computed by PubChem (NCBI)