Products 2225174-08-1
CAS 2225174-08-1 is the registry number for 5–Chloro–6–(iso–butyl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[5-chloro-6-(2-methylpropyl)-3-pyridinyl]boronic acid (CAS 2225174-08-1) is a chemical compound with the molecular formula C9H13BClNO2 and a molecular weight of 213.47 g/mol. IUPAC name: [5-chloro-6-(2-methylpropyl)-3-pyridinyl]boronic acid. InChIKey: QJTXVDQCFNAGCG-UHFFFAOYSA-N.
| Molecular formula | C9H13BClNO2 |
|---|---|
| Molecular weight | 213.47 g/mol |
| IUPAC name | [5-chloro-6-(2-methylpropyl)-3-pyridinyl]boronic acid |
| InChIKey | QJTXVDQCFNAGCG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)CC(C)C)Cl)(O)O |
Computed by PubChem (NCBI)