cas: 957060-76-3 — see every product listed under this CAS number, including other names
(4-(2-Carbamothioylhydrazinecarbonyl)phenyl)boronic acid, ≥98%, ≥98% (CAS 957060-76-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117BSG-250mg |
| cas | 957060-76-3 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 918.80 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
[4-[(carbamothioylamino)carbamoyl]phenyl]boronic acid (CAS 957060-76-3) is a chemical compound with the molecular formula C8H10BN3O3S and a molecular weight of 239.06 g/mol. IUPAC name: [4-[(carbamothioylamino)carbamoyl]phenyl]boronic acid. InChIKey: NVXNXTLWXKMYHB-UHFFFAOYSA-N.
| Molecular formula | C8H10BN3O3S |
|---|---|
| Molecular weight | 239.06 g/mol |
| IUPAC name | [4-[(carbamothioylamino)carbamoyl]phenyl]boronic acid |
| InChIKey | NVXNXTLWXKMYHB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NNC(=S)N)(O)O |
Computed by PubChem (NCBI)