CAS 957060-76-3 appears in our catalog under these names: 2-(4-Boronobenzoyl)hydrazinecarbothioamide, 98%, (4-(2-Carbamothioylhydrazinecarbonyl)phenyl)boronic acid, 98%, (4-(2-Carbamothioylhydrazinecarbonyl)phenyl)boronic acid, ≥98%, ≥98%, (4-(2-Carbamothioylhydrazine-1-carbonyl)phenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[4-[(carbamothioylamino)carbamoyl]phenyl]boronic acid (CAS 957060-76-3) is a chemical compound with the molecular formula C8H10BN3O3S and a molecular weight of 239.06 g/mol. IUPAC name: [4-[(carbamothioylamino)carbamoyl]phenyl]boronic acid. InChIKey: NVXNXTLWXKMYHB-UHFFFAOYSA-N.
| Molecular formula | C8H10BN3O3S |
|---|---|
| Molecular weight | 239.06 g/mol |
| IUPAC name | [4-[(carbamothioylamino)carbamoyl]phenyl]boronic acid |
| InChIKey | NVXNXTLWXKMYHB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NNC(=S)N)(O)O |
Computed by PubChem (NCBI)