cas: 1258650-13-3 — see every product listed under this CAS number, including other names
(4-(2-Chlorophenyl)tetrahydro-2H-pyran-4-yl)methanamine hydrochloride (CAS 1258650-13-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AB5R-100mg |
| cas | 1258650-13-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 530.00 Pln | |
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 1g | 1922.00 Pln |
| delivery time | 3 weeks |
|---|
[4-(2-chlorophenyl)oxan-4-yl]methanamine;hydrochloride (CAS 1258650-13-3) is a chemical compound with the molecular formula C12H17Cl2NO and a molecular weight of 262.17 g/mol. IUPAC name: [4-(2-chlorophenyl)oxan-4-yl]methanamine;hydrochloride. InChIKey: OOMNMFQNVRSXBT-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2NO |
|---|---|
| Molecular weight | 262.17 g/mol |
| IUPAC name | [4-(2-chlorophenyl)oxan-4-yl]methanamine;hydrochloride |
| InChIKey | OOMNMFQNVRSXBT-UHFFFAOYSA-N |
| SMILES | C1COCCC1(CN)C2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)