CAS 2412008-47-8 is the registry number for (2R,4R)-4-(2-Chlorophenoxy)-2-methylpiperidine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4R)-4-(2-chlorophenoxy)-2-methylpiperidine;hydrochloride (CAS 2412008-47-8) is a chemical compound with the molecular formula C12H17Cl2NO and a molecular weight of 262.17 g/mol. IUPAC name: (2R,4R)-4-(2-chlorophenoxy)-2-methylpiperidine;hydrochloride. InChIKey: PHDYFJYTFMQZCE-DHTOPLTISA-N.
| Molecular formula | C12H17Cl2NO |
|---|---|
| Molecular weight | 262.17 g/mol |
| IUPAC name | (2R,4R)-4-(2-chlorophenoxy)-2-methylpiperidine;hydrochloride |
| InChIKey | PHDYFJYTFMQZCE-DHTOPLTISA-N |
| SMILES | C[C@@H]1C[C@@H](CCN1)OC2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)