CAS 179942-55-3 appears in our catalog under these names: 4–(Tetrazol–5–yl)phenylboronic acid, 4-(Tetrazol-5-yl)phenylboronic acid, 97%, 4-(1H-TETRAZOL-5-YL)PHENYLBORONIC ACID, (4-(2H-Tetrazol-5-yl)phenyl)boronic acid, 98%, 98%, [4-(1H-1,2,3,4-tetrazol-5-yl)phenyl]boronic acid, 98%. Offered by: GLPBio, Thermo Scientific (Acros), Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg.
[4-(2H-tetrazol-5-yl)phenyl]boronic acid (CAS 179942-55-3) is a chemical compound with the molecular formula C7H7BN4O2 and a molecular weight of 189.97 g/mol. IUPAC name: [4-(2H-tetrazol-5-yl)phenyl]boronic acid. InChIKey: DXUPJOQUAAVAGV-UHFFFAOYSA-N.
| Molecular formula | C7H7BN4O2 |
|---|---|
| Molecular weight | 189.97 g/mol |
| IUPAC name | [4-(2H-tetrazol-5-yl)phenyl]boronic acid |
| InChIKey | DXUPJOQUAAVAGV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=NNN=N2)(O)O |
Computed by PubChem (NCBI)