CAS 155884-01-8 appears in our catalog under these names: 2–(Tetrazol–5–yl)phenylboronic acid, 2-(Tetrazol-5-yl)phenylboronic acid, 95%, (2-(1H-Tetrazol-5-yl)phenyl)boronic acid 97%, 2-(TETRAZOL-5-YL)PHENYLBORONIC ACID, >=&, [2-(1H-1,2,3,4-tetrazol-5-yl)phenyl]boronic acid, 97%. Offered by: GLPBio, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 500MG.
[2-(2H-tetrazol-5-yl)phenyl]boronic acid (CAS 155884-01-8) is a chemical compound with the molecular formula C7H7BN4O2 and a molecular weight of 189.97 g/mol. IUPAC name: [2-(2H-tetrazol-5-yl)phenyl]boronic acid. InChIKey: GVRXWYFECKHTSJ-UHFFFAOYSA-N.
| Molecular formula | C7H7BN4O2 |
|---|---|
| Molecular weight | 189.97 g/mol |
| IUPAC name | [2-(2H-tetrazol-5-yl)phenyl]boronic acid |
| InChIKey | GVRXWYFECKHTSJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C2=NNN=N2)(O)O |
Computed by PubChem (NCBI)