(4-(3-(1-Piperidinyl)propoxy)phenyl)boronic acid, 95-<97%
cas: 1003028-39-4 — see every product listed under this CAS number, including other names
(4-(3-(1-Piperidinyl)propoxy)phenyl)boronic acid, 95-<97% (CAS 1003028-39-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC33-95-97-1g |
| cas | 1003028-39-4 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 4136.00 Pln | |
| Hoffman Fine Chemicals | 2,5g | 7000.62 Pln | |
| Hoffman Fine Chemicals | 5g | 11020.02 Pln | |
| Hoffman Fine Chemicals | 10g | 17444.68 Pln | |
| Hoffman Fine Chemicals | 25g | 36725.04 Pln |
properties
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
[4-(3-piperidin-1-ylpropoxy)phenyl]boronic acid (CAS 1003028-39-4) is a chemical compound with the molecular formula C14H22BNO3 and a molecular weight of 263.14 g/mol. IUPAC name: [4-(3-piperidin-1-ylpropoxy)phenyl]boronic acid. InChIKey: WXZPCHIROFGLEC-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO3 |
|---|---|
| Molecular weight | 263.14 g/mol |
| IUPAC name | [4-(3-piperidin-1-ylpropoxy)phenyl]boronic acid |
| InChIKey | WXZPCHIROFGLEC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCCN2CCCCC2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
{4-[3-(piperidin-1-yl)propoxy]phenyl}boronic acid, (4-(3-(Piperidin-1-yl)propoxy)phenyl)boronic acid, [4-(3-piperidin-1-ylpropoxy)phenyl]boronic acid, [4-[3-(1-piperidyl)propoxy]phenyl]boronic acid, [4-[3-(1-Piperidinyl)propoxy]phenyl]boronic acid, {4-[3-(piperidin-1-yl)propoxy]phenyl}boronicacid