CAS 1257554-10-1 appears in our catalog under these names: 2-Isopropoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%, 2-Isopropoxypyridine-4-boronic acid pinacol ester. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
2-propan-2-yloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1257554-10-1) is a chemical compound with the molecular formula C14H22BNO3 and a molecular weight of 263.14 g/mol. IUPAC name: 2-propan-2-yloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: BGNOHXLPSYAJCZ-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO3 |
|---|---|
| Molecular weight | 263.14 g/mol |
| IUPAC name | 2-propan-2-yloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | BGNOHXLPSYAJCZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)OC(C)C |
Computed by PubChem (NCBI)