(4-(3-Fluorophenoxy)phenyl)boronic acid, 97%
cas: 1029438-36-5 — see every product listed under this CAS number, including other names
(4-(3-Fluorophenoxy)phenyl)boronic acid, 97% (CAS 1029438-36-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211474-100MG |
| cas | 1029438-36-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 575.86 Pln | |
| Fluorochem | 5g | 2663.66 Pln | |
| Fluorochem | 10g | 5266.91 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[4-(3-fluorophenoxy)phenyl]boronic acid (CAS 1029438-36-5) is a chemical compound with the molecular formula C12H10BFO3 and a molecular weight of 232.02 g/mol. IUPAC name: [4-(3-fluorophenoxy)phenyl]boronic acid. InChIKey: GJKLNXCGVYJBRK-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO3 |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | [4-(3-fluorophenoxy)phenyl]boronic acid |
| InChIKey | GJKLNXCGVYJBRK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2=CC(=CC=C2)F)(O)O |
Computed by PubChem (NCBI)