Products 1402238-32-7
CAS 1402238-32-7 appears in our catalog under these names: 4-(2-Fluorophenoxy)phenylboronic acid 98%, 4-(2-Fluorophenoxy)phenylboronic acid, 98%, 98%, (4-(2-Fluorophenoxy)phenyl)boronic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-(2-fluorophenoxy)phenyl]boronic acid (CAS 1402238-32-7) is a chemical compound with the molecular formula C12H10BFO3 and a molecular weight of 232.02 g/mol. IUPAC name: [4-(2-fluorophenoxy)phenyl]boronic acid. InChIKey: IQNYGJLCROJQSI-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO3 |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | [4-(2-fluorophenoxy)phenyl]boronic acid |
| InChIKey | IQNYGJLCROJQSI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2=CC=CC=C2F)(O)O |
Computed by PubChem (NCBI)