cas: 850568-55-7 — see every product listed under this CAS number, including other names
(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanamine hydrochloride 98% (CAS 850568-55-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A288973-250mg |
| cas | 850568-55-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1099.06 Pln | |
| Ambeed | 10g | 1927.88 Pln | |
| Ambeed | 25g | 3185.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A288973 |
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine;hydrochloride (CAS 850568-55-7) is a chemical compound with the molecular formula C13H21BClNO2 and a molecular weight of 269.58 g/mol. IUPAC name: [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine;hydrochloride. InChIKey: KPECMJIHZZWTJN-UHFFFAOYSA-N.
| Molecular formula | C13H21BClNO2 |
|---|---|
| Molecular weight | 269.58 g/mol |
| IUPAC name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine;hydrochloride |
| InChIKey | KPECMJIHZZWTJN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)