CAS 2490665-87-5 is the registry number for 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzylamine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 10g, 1g.
[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine;hydrochloride (CAS 2490665-87-5) is a chemical compound with the molecular formula C13H21BClNO2 and a molecular weight of 269.58 g/mol. IUPAC name: [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine;hydrochloride. InChIKey: GYLCMZOZOWMCPW-UHFFFAOYSA-N.
| Molecular formula | C13H21BClNO2 |
|---|---|
| Molecular weight | 269.58 g/mol |
| IUPAC name | [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine;hydrochloride |
| InChIKey | GYLCMZOZOWMCPW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CN.Cl |
Computed by PubChem (NCBI)