(4-(4-(Trifluoromethoxy)phenoxy)phenyl)boronic acid, 96%, 96%
cas: 958457-41-5 — see every product listed under this CAS number, including other names
(4-(4-(Trifluoromethoxy)phenoxy)phenyl)boronic acid, 96%, 96% (CAS 958457-41-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H8B1-100mg |
| cas | 958457-41-5 |
| size | 100mg |
| availability | 12g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2819.60 Pln | |
| Chemat | 10g | 5229.20 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[4-[4-(trifluoromethoxy)phenoxy]phenyl]boronic acid (CAS 958457-41-5) is a chemical compound with the molecular formula C13H10BF3O4 and a molecular weight of 298.02 g/mol. IUPAC name: [4-[4-(trifluoromethoxy)phenoxy]phenyl]boronic acid. InChIKey: SIWUQLYUFGJITE-UHFFFAOYSA-N.
| Molecular formula | C13H10BF3O4 |
|---|---|
| Molecular weight | 298.02 g/mol |
| IUPAC name | [4-[4-(trifluoromethoxy)phenoxy]phenyl]boronic acid |
| InChIKey | SIWUQLYUFGJITE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2=CC=C(C=C2)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
{4-[4-(Trifluoromethoxy)phenoxy]phenyl}boronic acid, (4-(4-(Trifluoromethoxy)phenoxy)phenyl)boronic acid, [4-[4-(trifluoromethoxy)phenoxy]phenyl]boronic acid, (4-(4-(Trifluoromethoxy)phenoxy)-phenyl)boronic acid, (4-(4-(Trifluoromethoxy)phenoxy)phenyl)boronicacid, [4-(4-Trifluoromethoxyphenoxy)phenyl]boronic acid, 4-(4-(trifluoromethoxy)phenoxy)phenylboronic acid, (4-(4-(trifluoromethoxy)phenoxy)phenyl) boronic acid, (4-(4-(trifluoromethoxy) phenoxy) phenyl) boronic acid, (4-(4-(trifluoromethoxy)phenoxy) phenyl) boronic acid