CAS 958457-41-5 appears in our catalog under these names: {4-[4-(Trifluoromethoxy)phenoxy]phenyl}boronic acid, 96%, {4-(4-(Trifluoromethoxy)phenoxy)phenyl}boronic acid, (4-(4-(Trifluoromethoxy)phenoxy)phenyl)boronic acid 96%, (4-(4-(Trifluoromethoxy)phenoxy)phenyl)boronic acid, 96%, 96%, (4-(4-(Trifluoromethoxy)phenoxy)phenyl)boronic acid, 96%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 100mg, 5g, 10g.
[4-[4-(trifluoromethoxy)phenoxy]phenyl]boronic acid (CAS 958457-41-5) is a chemical compound with the molecular formula C13H10BF3O4 and a molecular weight of 298.02 g/mol. IUPAC name: [4-[4-(trifluoromethoxy)phenoxy]phenyl]boronic acid. InChIKey: SIWUQLYUFGJITE-UHFFFAOYSA-N.
| Molecular formula | C13H10BF3O4 |
|---|---|
| Molecular weight | 298.02 g/mol |
| IUPAC name | [4-[4-(trifluoromethoxy)phenoxy]phenyl]boronic acid |
| InChIKey | SIWUQLYUFGJITE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2=CC=C(C=C2)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)