cas: 361437-00-5 — see every product listed under this CAS number, including other names
(4-(4-Fluorophenoxy)phenyl)boronic acid, 98% (CAS 361437-00-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242933-250MG |
| cas | 361437-00-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1690.05 Pln | |
| Fluorochem | 10g | 2101.36 Pln | |
| Fluorochem | 25g | 4532.80 Pln | |
| Fluorochem | 100g | 13779.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[4-(4-fluorophenoxy)phenyl]boronic acid (CAS 361437-00-5) is a chemical compound with the molecular formula C12H10BFO3 and a molecular weight of 232.02 g/mol. IUPAC name: [4-(4-fluorophenoxy)phenyl]boronic acid. InChIKey: BXLDWIUCAAJXIZ-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO3 |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | [4-(4-fluorophenoxy)phenyl]boronic acid |
| InChIKey | BXLDWIUCAAJXIZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)