cas: 889939-79-1 — see every product listed under this CAS number, including other names
(4-(4-Fluorophenyl)tetrahydro-2H-pyran-4-yl)methanamine, 98+% (CAS 889939-79-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A740329-5g |
| cas | 889939-79-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5525.38 Pln | |
| AmBeed | 100mg | 577.78 Pln | |
| AmBeed | 10g | 8155.42 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-(4-fluorophenyl)oxan-4-yl]methanamine (CAS 889939-79-1) is a chemical compound with the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. IUPAC name: [4-(4-fluorophenyl)oxan-4-yl]methanamine. InChIKey: RJNKDRCJNIVDII-UHFFFAOYSA-N.
| Molecular formula | C12H16FNO |
|---|---|
| Molecular weight | 209.26 g/mol |
| IUPAC name | [4-(4-fluorophenyl)oxan-4-yl]methanamine |
| InChIKey | RJNKDRCJNIVDII-UHFFFAOYSA-N |
| SMILES | C1COCCC1(CN)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)