cas: 889939-79-1 — see every product listed under this CAS number, including other names
4-(4-Fluorophenyl)tetrahydro-2H-pyran-4-methanamine, 95%, 95% (CAS 889939-79-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 500mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11551F-25mg |
| cas | 889939-79-1 |
| size | 25mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 184.40 Pln | |
| Chemat | 500mg | 1240.40 Pln | |
| Chemat | 50mg | 294.80 Pln | |
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 890.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(4-fluorophenyl)oxan-4-yl]methanamine (CAS 889939-79-1) is a chemical compound with the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. IUPAC name: [4-(4-fluorophenyl)oxan-4-yl]methanamine. InChIKey: RJNKDRCJNIVDII-UHFFFAOYSA-N.
| Molecular formula | C12H16FNO |
|---|---|
| Molecular weight | 209.26 g/mol |
| IUPAC name | [4-(4-fluorophenyl)oxan-4-yl]methanamine |
| InChIKey | RJNKDRCJNIVDII-UHFFFAOYSA-N |
| SMILES | C1COCCC1(CN)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)