cas: 252663-48-2 — see every product listed under this CAS number, including other names
(4-(Butylcarbamoyl)phenyl)boronic acid, 95% (CAS 252663-48-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219078-1G |
| cas | 252663-48-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 419.66 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[4-(butylcarbamoyl)phenyl]boronic acid (CAS 252663-48-2) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [4-(butylcarbamoyl)phenyl]boronic acid. InChIKey: YPXNMPMFCXGXPU-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | [4-(butylcarbamoyl)phenyl]boronic acid |
| InChIKey | YPXNMPMFCXGXPU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCCCC)(O)O |
Computed by PubChem (NCBI)