CAS 25069-40-3 appears in our catalog under these names: (4-(DiPhenylamino)Phenyl)Methanol, 98%, 98%, (4-(Diphenylamino)phenyl)methanol, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-(N-phenylanilino)phenyl]methanol (CAS 25069-40-3) is a chemical compound with the molecular formula C19H17NO and a molecular weight of 275.3 g/mol. IUPAC name: [4-(N-phenylanilino)phenyl]methanol. InChIKey: FJNLLLILLNFUCS-UHFFFAOYSA-N.
| Molecular formula | C19H17NO |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | [4-(N-phenylanilino)phenyl]methanol |
| InChIKey | FJNLLLILLNFUCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)CO |
Computed by PubChem (NCBI)