CAS 897035-09-5 is the registry number for 2-(1,2,3,4-Tetrahydroisoquinolin-1-yl)-1-naphthol, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
2-(1,2,3,4-tetrahydroisoquinolin-1-yl)naphthalen-1-ol (CAS 897035-09-5) is a chemical compound with the molecular formula C19H17NO and a molecular weight of 275.3 g/mol. IUPAC name: 2-(1,2,3,4-tetrahydroisoquinolin-1-yl)naphthalen-1-ol. InChIKey: HDAWKBGPOULHDO-UHFFFAOYSA-N.
| Molecular formula | C19H17NO |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 2-(1,2,3,4-tetrahydroisoquinolin-1-yl)naphthalen-1-ol |
| InChIKey | HDAWKBGPOULHDO-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=CC=CC=C21)C3=C(C4=CC=CC=C4C=C3)O |
Computed by PubChem (NCBI)