(4-(Ethoxycarbonyl)cyclohex-1-en-1-yl)boronic acid, 97%
cas: 1443112-50-2 — see every product listed under this CAS number, including other names
(4-(Ethoxycarbonyl)cyclohex-1-en-1-yl)boronic acid, 97% (CAS 1443112-50-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A451590-250mg |
| cas | 1443112-50-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| BLDpharm | 100mg | 181.07 Pln | |
| BLDpharm | 250mg | 247.72 Pln | |
| BLDpharm | 1g | 364.34 Pln | |
| BLDpharm | 5g | 975.24 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Fluorochem | 1g | 336.36 Pln | |
| Fluorochem | 5g | 893.45 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(4-ethoxycarbonylcyclohexen-1-yl)boronic acid (CAS 1443112-50-2) is a chemical compound with the molecular formula C9H15BO4 and a molecular weight of 198.03 g/mol. IUPAC name: (4-ethoxycarbonylcyclohexen-1-yl)boronic acid. InChIKey: KUDDGNMOBOAZAX-UHFFFAOYSA-N.
| Molecular formula | C9H15BO4 |
|---|---|
| Molecular weight | 198.03 g/mol |
| IUPAC name | (4-ethoxycarbonylcyclohexen-1-yl)boronic acid |
| InChIKey | KUDDGNMOBOAZAX-UHFFFAOYSA-N |
| SMILES | B(C1=CCC(CC1)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-(Ethoxycarbonyl)cyclohex-1-en-1-yl)boronic acid, (4-ethoxycarbonylcyclohexen-1-yl)boronic acid, [4-(ethoxycarbonyl)cyclohex-1-en-1-yl]boronic acid, 3-Cyclohexene-1-carboxylic acid, 4-borono-, 1-ethyl ester, 4-(Ethoxycarbonyl)cyclohexene-1-boronic Acid, (4-(Ethoxycarbonyl)cyclohex-1-en-1-yl)boronicacid, [4-(Ethoxycarbonyl)-1-cyclohexen-1-yl]boronic acid