CAS 144206-16-6 appears in our catalog under these names: (2E)-3-(Tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoic acid, 95%, (E)-3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)acrylic acid, 98%, (E)-3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)acrylic acid 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25mg, 50mg, 100mg, 250mg.
(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoic acid (CAS 144206-16-6) is a chemical compound with the molecular formula C9H15BO4 and a molecular weight of 198.03 g/mol. IUPAC name: (E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoic acid. InChIKey: BSKAZYSWDPJQJL-AATRIKPKSA-N.
| Molecular formula | C9H15BO4 |
|---|---|
| Molecular weight | 198.03 g/mol |
| IUPAC name | (E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoic acid |
| InChIKey | BSKAZYSWDPJQJL-AATRIKPKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C(=O)O |
Computed by PubChem (NCBI)