(4-(Hydroxymethyl)phenyl)diphenylphosphine oxide, 97%
cas: 5068-20-2 — see every product listed under this CAS number, including other names
(4-(Hydroxymethyl)phenyl)diphenylphosphine oxide, 97% (CAS 5068-20-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1144248-250mg |
| cas | 5068-20-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1360.50 Pln | |
| Ambeed | 1g | 3479.81 Pln | |
| Ambeed | 5g | 13703.69 Pln | |
| Chemat | 100mg | 851.60 Pln | |
| Chemat | 250mg | 1398.80 Pln | |
| Chemat | 1g | 3674.00 Pln | |
| Chemat | 5g | 14507.60 Pln | |
| BLDpharm | 100mg | 891.93 Pln | |
| BLDpharm | 250mg | 1463.95 Pln | |
| BLDpharm | 1g | 3746.48 Pln | |
| BLDpharm | 5g | 14770.38 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(4-diphenylphosphorylphenyl)methanol (CAS 5068-20-2) is a chemical compound with the molecular formula C19H17O2P and a molecular weight of 308.3 g/mol. IUPAC name: (4-diphenylphosphorylphenyl)methanol. InChIKey: HYLFRHXYLLXNNF-UHFFFAOYSA-N.
| Molecular formula | C19H17O2P |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | (4-diphenylphosphorylphenyl)methanol |
| InChIKey | HYLFRHXYLLXNNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=C(C=C3)CO |
Computed by PubChem (NCBI)