CAS 5068-20-2 is the registry number for (4-(Hydroxymethyl)phenyl)diphenylphosphine oxide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-diphenylphosphorylphenyl)methanol (CAS 5068-20-2) is a chemical compound with the molecular formula C19H17O2P and a molecular weight of 308.3 g/mol. IUPAC name: (4-diphenylphosphorylphenyl)methanol. InChIKey: HYLFRHXYLLXNNF-UHFFFAOYSA-N.
| Molecular formula | C19H17O2P |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | (4-diphenylphosphorylphenyl)methanol |
| InChIKey | HYLFRHXYLLXNNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=C(C=C3)CO |
Computed by PubChem (NCBI)