(4-(Methoxycarbonyl)thiophen-2-yl)boronic acid, 97+%
cas: 1333313-18-0 — see every product listed under this CAS number, including other names
(4-(Methoxycarbonyl)thiophen-2-yl)boronic acid, 97+% (CAS 1333313-18-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1941986-100mg |
| cas | 1333313-18-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 809.81 Pln | |
| Ambeed | 250mg | 1260.38 Pln | |
| Ambeed | 1g | 3007.00 Pln | |
| BLDpharm | 100mg | 869.72 Pln | |
| BLDpharm | 250mg | 1352.88 Pln | |
| BLDpharm | 1g | 3235.55 Pln | |
| Chemat | 100mg | 765.20 Pln | |
| Chemat | 250mg | 1254.80 Pln | |
| Chemat | 1g | 3165.20 Pln |
properties
| purity | 97+% |
|---|---|
| delivery time | 2-3 weeks |
(4-methoxycarbonylthiophen-2-yl)boronic acid (CAS 1333313-18-0) is a chemical compound with the molecular formula C6H7BO4S and a molecular weight of 186.00 g/mol. IUPAC name: (4-methoxycarbonylthiophen-2-yl)boronic acid. InChIKey: LTGHNJFZPWSRGU-UHFFFAOYSA-N.
| Molecular formula | C6H7BO4S |
|---|---|
| Molecular weight | 186.00 g/mol |
| IUPAC name | (4-methoxycarbonylthiophen-2-yl)boronic acid |
| InChIKey | LTGHNJFZPWSRGU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CS1)C(=O)OC)(O)O |
Computed by PubChem (NCBI)