CAS 876189-21-8 appears in our catalog under these names: 5-(Methoxycarbonyl)thiophene-2-boronic acid, 96%, (5-(Methoxycarbonyl)thiophen-2-yl)boronic acid 98%, 5-Methoxycarbonylthiophene-2-boronic acid, 95%, 95%, 5-Methoxycarbonylthiophene-2-boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(5-methoxycarbonylthiophen-2-yl)boronic acid (CAS 876189-21-8) is a chemical compound with the molecular formula C6H7BO4S and a molecular weight of 186.00 g/mol. IUPAC name: (5-methoxycarbonylthiophen-2-yl)boronic acid. InChIKey: VJWFTDBWRPSNFS-UHFFFAOYSA-N.
| Molecular formula | C6H7BO4S |
|---|---|
| Molecular weight | 186.00 g/mol |
| IUPAC name | (5-methoxycarbonylthiophen-2-yl)boronic acid |
| InChIKey | VJWFTDBWRPSNFS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)C(=O)OC)(O)O |
Computed by PubChem (NCBI)