cas: 877-66-7 — see every product listed under this CAS number, including other names
(4-(Methylsulfonyl)phenyl)hydrazine, 98%, 98% (CAS 877-66-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115FB5-1g |
| cas | 877-66-7 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 462.80 Pln | |
| Chemat | 25g | 818.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-methylsulfonylphenyl)hydrazine (CAS 877-66-7) is a chemical compound with the molecular formula C7H10N2O2S and a molecular weight of 186.23 g/mol. IUPAC name: (4-methylsulfonylphenyl)hydrazine. InChIKey: ZHYAENSFCNMJQQ-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O2S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | (4-methylsulfonylphenyl)hydrazine |
| InChIKey | ZHYAENSFCNMJQQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)NN |
Computed by PubChem (NCBI)