CAS 4810-41-7 appears in our catalog under these names: N,N-Dimethylpyridine-3-sulfonamide, 97%, N,N-Dimethylpyridine-3-sulphonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 100g, 1g, 10g.
N,N-dimethylpyridine-3-sulfonamide (CAS 4810-41-7) is a chemical compound with the molecular formula C7H10N2O2S and a molecular weight of 186.23 g/mol. IUPAC name: N,N-dimethylpyridine-3-sulfonamide. InChIKey: HGZULNNLLFYOFI-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O2S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | N,N-dimethylpyridine-3-sulfonamide |
| InChIKey | HGZULNNLLFYOFI-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CN=CC=C1 |
Computed by PubChem (NCBI)