cas: 957062-69-0 — see every product listed under this CAS number, including other names
(4-(N-(3-Chlorophenyl)sulfamoyl)phenyl)boronic acid 95% (CAS 957062-69-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A339745-1g |
| cas | 957062-69-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 25g | 1327.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A339745 |
[4-[(3-chlorophenyl)sulfamoyl]phenyl]boronic acid (CAS 957062-69-0) is a chemical compound with the molecular formula C12H11BClNO4S and a molecular weight of 311.6 g/mol. IUPAC name: [4-[(3-chlorophenyl)sulfamoyl]phenyl]boronic acid. InChIKey: RFMJCHDJLPORGS-UHFFFAOYSA-N.
| Molecular formula | C12H11BClNO4S |
|---|---|
| Molecular weight | 311.6 g/mol |
| IUPAC name | [4-[(3-chlorophenyl)sulfamoyl]phenyl]boronic acid |
| InChIKey | RFMJCHDJLPORGS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC2=CC(=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)