Products 957062-69-0

CAS 957062-69-0 appears in our catalog under these names: 4-(N-(3-Chlorophenyl)sulfamoyl)phenylboronic acid, 95%, (4-(N-(3-Chlorophenyl)sulfamoyl)phenyl)boronic acid 95%, (4-(N-(3-Chlorophenyl)sulfamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.

Structural formula: {0} (CAS {1})

[4-[(3-chlorophenyl)sulfamoyl]phenyl]boronic acid (CAS 957062-69-0) is a chemical compound with the molecular formula C12H11BClNO4S and a molecular weight of 311.6 g/mol. IUPAC name: [4-[(3-chlorophenyl)sulfamoyl]phenyl]boronic acid. InChIKey: RFMJCHDJLPORGS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11BClNO4S
Molecular weight311.6 g/mol
IUPAC name[4-[(3-chlorophenyl)sulfamoyl]phenyl]boronic acid
InChIKeyRFMJCHDJLPORGS-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)S(=O)(=O)NC2=CC(=CC=C2)Cl)(O)O

Computed by PubChem (NCBI)