CAS 957062-69-0 appears in our catalog under these names: 4-(N-(3-Chlorophenyl)sulfamoyl)phenylboronic acid, 95%, (4-(N-(3-Chlorophenyl)sulfamoyl)phenyl)boronic acid 95%, (4-(N-(3-Chlorophenyl)sulfamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.
[4-[(3-chlorophenyl)sulfamoyl]phenyl]boronic acid (CAS 957062-69-0) is a chemical compound with the molecular formula C12H11BClNO4S and a molecular weight of 311.6 g/mol. IUPAC name: [4-[(3-chlorophenyl)sulfamoyl]phenyl]boronic acid. InChIKey: RFMJCHDJLPORGS-UHFFFAOYSA-N.
| Molecular formula | C12H11BClNO4S |
|---|---|
| Molecular weight | 311.6 g/mol |
| IUPAC name | [4-[(3-chlorophenyl)sulfamoyl]phenyl]boronic acid |
| InChIKey | RFMJCHDJLPORGS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC2=CC(=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)