cas: 957120-99-9 — see every product listed under this CAS number, including other names
(4-(N-(4-Fluoro-3-methoxyphenyl)sulfamoyl)phenyl)boronic acid, 98% (CAS 957120-99-9) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213411-5G |
| cas | 957120-99-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 643.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-[(4-fluoro-3-methoxyphenyl)sulfamoyl]phenyl]boronic acid (CAS 957120-99-9) is a chemical compound with the molecular formula C13H13BFNO5S and a molecular weight of 325.1 g/mol. IUPAC name: [4-[(4-fluoro-3-methoxyphenyl)sulfamoyl]phenyl]boronic acid. InChIKey: XNUBPWLAGSNZKR-UHFFFAOYSA-N.
| Molecular formula | C13H13BFNO5S |
|---|---|
| Molecular weight | 325.1 g/mol |
| IUPAC name | [4-[(4-fluoro-3-methoxyphenyl)sulfamoyl]phenyl]boronic acid |
| InChIKey | XNUBPWLAGSNZKR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C=C2)F)OC)(O)O |
Computed by PubChem (NCBI)