CAS 957120-99-9 appears in our catalog under these names: 4-(N-(4-Fluoro-3-methoxyphenyl)sulfamoyl)phenylboronic acid, 98%, (4-(N-(4-Fluoro-3-methoxyphenyl)sulfamoyl)phenyl)boronic acid 98%, 4-(N-(4-Fluoro-3-methoxyphenyl)sulfamoyl)phenylboronic acid, 98%, 98%, (4-(N-(4-Fluoro-3-methoxyphenyl)sulfamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.
[4-[(4-fluoro-3-methoxyphenyl)sulfamoyl]phenyl]boronic acid (CAS 957120-99-9) is a chemical compound with the molecular formula C13H13BFNO5S and a molecular weight of 325.1 g/mol. IUPAC name: [4-[(4-fluoro-3-methoxyphenyl)sulfamoyl]phenyl]boronic acid. InChIKey: XNUBPWLAGSNZKR-UHFFFAOYSA-N.
| Molecular formula | C13H13BFNO5S |
|---|---|
| Molecular weight | 325.1 g/mol |
| IUPAC name | [4-[(4-fluoro-3-methoxyphenyl)sulfamoyl]phenyl]boronic acid |
| InChIKey | XNUBPWLAGSNZKR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C=C2)F)OC)(O)O |
Computed by PubChem (NCBI)