cas: 548769-96-6 — see every product listed under this CAS number, including other names
(4-(N-Benzylsulfamoyl)phenyl)boronic acid, 98% (CAS 548769-96-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235431-1G |
| cas | 548769-96-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 622.72 Pln | |
| Fluorochem | 5g | 1971.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-(benzylsulfamoyl)phenyl]boronic acid (CAS 548769-96-6) is a chemical compound with the molecular formula C13H14BNO4S and a molecular weight of 291.1 g/mol. IUPAC name: [4-(benzylsulfamoyl)phenyl]boronic acid. InChIKey: LRHAPENXSWTNOS-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO4S |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | [4-(benzylsulfamoyl)phenyl]boronic acid |
| InChIKey | LRHAPENXSWTNOS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)