Products 957062-88-3

CAS 957062-88-3 is the registry number for N-p-Tolyl 4-boronobenzenesulfonamide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[4-[(4-methylphenyl)sulfamoyl]phenyl]boronic acid (CAS 957062-88-3) is a chemical compound with the molecular formula C13H14BNO4S and a molecular weight of 291.1 g/mol. IUPAC name: [4-[(4-methylphenyl)sulfamoyl]phenyl]boronic acid. InChIKey: RGJGYRYMFMLJEU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14BNO4S
Molecular weight291.1 g/mol
IUPAC name[4-[(4-methylphenyl)sulfamoyl]phenyl]boronic acid
InChIKeyRGJGYRYMFMLJEU-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)C)(O)O

Computed by PubChem (NCBI)