CAS 957062-88-3 is the registry number for N-p-Tolyl 4-boronobenzenesulfonamide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
[4-[(4-methylphenyl)sulfamoyl]phenyl]boronic acid (CAS 957062-88-3) is a chemical compound with the molecular formula C13H14BNO4S and a molecular weight of 291.1 g/mol. IUPAC name: [4-[(4-methylphenyl)sulfamoyl]phenyl]boronic acid. InChIKey: RGJGYRYMFMLJEU-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO4S |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | [4-[(4-methylphenyl)sulfamoyl]phenyl]boronic acid |
| InChIKey | RGJGYRYMFMLJEU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)C)(O)O |
Computed by PubChem (NCBI)