cas: 913835-97-9 — see every product listed under this CAS number, including other names
(4-(N-Butyl-N-(4-methoxybenzyl)sulfamoyl)phenyl)boronic acid 98% (CAS 913835-97-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A294678-250mg |
| cas | 913835-97-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 437.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A294678 |
[4-[butyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid (CAS 913835-97-9) is a chemical compound with the molecular formula C18H24BNO5S and a molecular weight of 377.3 g/mol. IUPAC name: [4-[butyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid. InChIKey: RODHNOCSWOOPDD-UHFFFAOYSA-N.
| Molecular formula | C18H24BNO5S |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | [4-[butyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid |
| InChIKey | RODHNOCSWOOPDD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N(CCCC)CC2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)