CAS 913835-97-9 appears in our catalog under these names: 4-(N-Butyl-N-(4-methoxybenzyl)sulfamoyl)phenylboronic acid, 98%, (4-(N-Butyl-N-(4-methoxybenzyl)sulfamoyl)phenyl)boronic acid 98%, B-[4-[[Butyl[(4-methoxyphenyl)methyl]amino]sulfonyl]phenyl]boronic acid, 98%, 98%, (4-(N-Butyl-N-(4-methoxybenzyl)sulfamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[4-[butyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid (CAS 913835-97-9) is a chemical compound with the molecular formula C18H24BNO5S and a molecular weight of 377.3 g/mol. IUPAC name: [4-[butyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid. InChIKey: RODHNOCSWOOPDD-UHFFFAOYSA-N.
| Molecular formula | C18H24BNO5S |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | [4-[butyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid |
| InChIKey | RODHNOCSWOOPDD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N(CCCC)CC2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)