(4-(Octyloxy)phenyl)boronic acid, 97%
cas: 121554-09-4 — see every product listed under this CAS number, including other names
(4-(Octyloxy)phenyl)boronic acid, 97% (CAS 121554-09-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F219102-250MG |
| cas | 121554-09-4 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 232.23 Pln | |
| Fluorochem | 25g | 445.69 Pln | |
| Fluorochem | 100g | 1388.07 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 231.31 Pln | |
| Ambeed | 25g | 442.69 Pln | |
| Ambeed | 100g | 1338.25 Pln | |
| Chemat | 100g | 1192.40 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 218.00 Pln | |
| Chemat | 25g | 362.00 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(4-octoxyphenyl)boronic acid (CAS 121554-09-4) is a chemical compound with the molecular formula C14H23BO3 and a molecular weight of 250.14 g/mol. IUPAC name: (4-octoxyphenyl)boronic acid. InChIKey: WABZSVITXOJJKH-UHFFFAOYSA-N.
| Molecular formula | C14H23BO3 |
|---|---|
| Molecular weight | 250.14 g/mol |
| IUPAC name | (4-octoxyphenyl)boronic acid |
| InChIKey | WABZSVITXOJJKH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCCCCCCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-n-Octyloxyphenylboronic Acid (contains varying amounts of Anhydride), 4-Octyloxyphenylboronic acid, (4-(Octyloxy)phenyl)boronic acid, 4-(n-Octyloxy)benzeneboronic acid, 4-(octyloxy)phenylboronic acid, (4-octoxyphenyl)boronic Acid, Boronic acid, B-[4-(octyloxy)phenyl]-, [4-(octyloxy)phenyl]boronic acid, 4-n-Octyloxyphenylboronic Acid, Boronic acid, [4-(octyloxy)phenyl]-