Products 121554-09-4
CAS 121554-09-4 appears in our catalog under these names: (4-(Octyloxy)phenyl)boronic acid, 97%, 4–n–Octyloxyphenylboronic Acid (contains varying amounts of Anhydride), 4-n-Octyloxyphenylboronic Acid (contains varying amounts of Anhydride). Offered by: Fluorochem, Ambeed, Chemat, GLPBio, TCI. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
(4-octoxyphenyl)boronic acid (CAS 121554-09-4) is a chemical compound with the molecular formula C14H23BO3 and a molecular weight of 250.14 g/mol. IUPAC name: (4-octoxyphenyl)boronic acid. InChIKey: WABZSVITXOJJKH-UHFFFAOYSA-N.
| Molecular formula | C14H23BO3 |
|---|---|
| Molecular weight | 250.14 g/mol |
| IUPAC name | (4-octoxyphenyl)boronic acid |
| InChIKey | WABZSVITXOJJKH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCCCCCCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-n-Octyloxyphenylboronic Acid (contains varying amounts of Anhydride), 4-Octyloxyphenylboronic acid, (4-(Octyloxy)phenyl)boronic acid, 4-(n-Octyloxy)benzeneboronic acid, 4-(octyloxy)phenylboronic acid, (4-octoxyphenyl)boronic Acid, Boronic acid, B-[4-(octyloxy)phenyl]-, [4-(octyloxy)phenyl]boronic acid, 4-n-Octyloxyphenylboronic Acid, Boronic acid, [4-(octyloxy)phenyl]-