cas: 486422-58-6 — see every product listed under this CAS number, including other names
(4-(Piperidin-1-ylsulfonyl)phenyl)boronic acid, 98%, 98% (CAS 486422-58-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D0R8-250mg |
| cas | 486422-58-6 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 429.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-piperidin-1-ylsulfonylphenyl)boronic acid (CAS 486422-58-6) is a chemical compound with the molecular formula C11H16BNO4S and a molecular weight of 269.13 g/mol. IUPAC name: (4-piperidin-1-ylsulfonylphenyl)boronic acid. InChIKey: MIEADZYHESCCES-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO4S |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | (4-piperidin-1-ylsulfonylphenyl)boronic acid |
| InChIKey | MIEADZYHESCCES-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N2CCCCC2)(O)O |
Computed by PubChem (NCBI)