Products 1704068-81-4
CAS 1704068-81-4 is the registry number for (4–Methyl–3–(pyrrolidin–1–ylsulfonyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)boronic acid (CAS 1704068-81-4) is a chemical compound with the molecular formula C11H16BNO4S and a molecular weight of 269.13 g/mol. IUPAC name: (4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)boronic acid. InChIKey: VDUFNJOAUXLGEH-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO4S |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | (4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)boronic acid |
| InChIKey | VDUFNJOAUXLGEH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)S(=O)(=O)N2CCCC2)(O)O |
Computed by PubChem (NCBI)