cas: 217189-04-3 — see every product listed under this CAS number, including other names
(4-(Pyridin-3-yl)phenyl)methanol, 97%, 97% (CAS 217189-04-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117ZXG-100mg |
| cas | 217189-04-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 794.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-pyridin-3-ylphenyl)methanol (CAS 217189-04-3) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: (4-pyridin-3-ylphenyl)methanol. InChIKey: ZHIJCVCCKVZBHE-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | (4-pyridin-3-ylphenyl)methanol |
| InChIKey | ZHIJCVCCKVZBHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)