CAS 33974-27-5 appears in our catalog under these names: Phenyl(pyridin-4-yl)methanol, 95%, Phenyl(pyridin-4-yl),methanol, 95%, 95%, Phenyl(pyridin-4-yl)methanol. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
Phenyl(pyridin-4-yl)methanol (CAS 33974-27-5) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: phenyl(pyridin-4-yl)methanol. InChIKey: MYKGGGPMKINROD-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | phenyl(pyridin-4-yl)methanol |
| InChIKey | MYKGGGPMKINROD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=NC=C2)O |
Computed by PubChem (NCBI)