cas: 1221448-69-6 — see every product listed under this CAS number, including other names
(4-{[(Benzyloxy)carbonyl](ethyl)amino}phenyl)boronic acid, 98%, 98% (CAS 1221448-69-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127UL-100mg |
| cas | 1221448-69-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 290.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-[ethyl(phenylmethoxycarbonyl)amino]phenyl]boronic acid (CAS 1221448-69-6) is a chemical compound with the molecular formula C16H18BNO4 and a molecular weight of 299.1 g/mol. IUPAC name: [4-[ethyl(phenylmethoxycarbonyl)amino]phenyl]boronic acid. InChIKey: ZQSANIXVXNVIRM-UHFFFAOYSA-N.
| Molecular formula | C16H18BNO4 |
|---|---|
| Molecular weight | 299.1 g/mol |
| IUPAC name | [4-[ethyl(phenylmethoxycarbonyl)amino]phenyl]boronic acid |
| InChIKey | ZQSANIXVXNVIRM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(CC)C(=O)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)